| ID | 1024 | |
| PMID | 23311648 | |
| Year | 2013 | |
| Sequence | GRKKRRQRRRPPQRKC | |
| Name | Tat | |
| Length | 16 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | HIV-1 | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | Tat enters cells by macropinocytosis, a specialized form of fluid-phase endocytosis that occurs in all cells | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Human tyrosinase plasmid (pAH7/Tyr, P) | |
| Assay | Vertical Franz diffusion cell | |
| Enhancer | Elastic cationic niosomes | |
| Properties of enhancer | Elastic niosome can squeeze themselves and pass through a small pore in stratum corneum, which is smaller than their vesicular size | |
| Concentration | 1ml solution containing 30 µg of tyrosinase plasmid,20µl of trypsin solution to hydrolyze the Tat | |
| Incubation time | 6 hours | |
| Tissue permeability (value with units) | Cumulative amounts0.10± 0.01 µg/cm2 and fluxes 0.60 ± 0.06 µg/cm2·h | |
| Tissue Sample | Acceptor compartment of Franz diffusion cell/Abdominal skin of Sprague–Dawley rats | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC [NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCC(=O) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N1CCC[C@H]1C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCC[NH3])C (=O)N[C@@H](CS)C=O | |