| ID | 1019 | |
| PMID | 23601371 | |
| Year | 2013 | |
| Sequence | KETWWETWWTEWSQP KKKRKV | |
| Name | Pep-1 | |
| Length | 21 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Derived from the simian virus 40 large T antigen | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | The formation of pores through the membrane might be involved in cellular penetration property of Pep-1 | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Elastin congo red | |
| Assay | In vivo imaging | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 50 µl (500 µM concentration of cargo) | |
| Incubation time | 3 hours | |
| Tissue permeability (value with units) | Significant permeability of the peptide can be seen in in vivo images | |
| Tissue Sample | Mouse skin cells | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCC(=O)O) C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](Cc1c [nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C (=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H] (C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C (=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N [C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC (=O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O) N[C@@H](CO)C(=O)N[C@@H](CCC(=O)N)C(=O) N1CCC[C@H]1C(=O)N[C@@H](CCCC[NH3])C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC [NH3])C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](C(C)C)C=O | |