| ID | 1009 | |
| PMID | 24602570 | |
| Year | 2014 | |
| Sequence | RRRRRRRRRRRLILV LLAI | |
| Name | 11R-No. 10 | |
| Length | 19 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Gliadin | |
| Nature of Peptide/Cargo | Melanogenesis inhibitory peptide | |
| Mechanism | Inhibition of intracelular melanin synthesis in melanocytes, control of intracellular melanin trafficking and blocking of extracellular stimulation of melanogenesis against melanocytes | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Confocal microscope | |
| Enhancer | PB (pyrenebutyrate) in propylene glycol [a mixture of 1 ml of PB (50 mM) and 99 ml of propylene glycol] | |
| Properties of enhancer | The ability to cross lipid bilayers and gain access to the cell interior by CPPs, especially poly-arginine, is enhanced in the presence of the hydrophobic counteranion 4-(1-pyrenyl)-butyric acid (pyrenebutyrate, PB) | |
| Concentration | TMR-11R [a mixture of 1.25 ml of TMR-11R (20 mM)] | |
| Incubation time | 6, 12, 24 and 48 hours | |
| Tissue permeability (value with units) | When TMR-11R was topically applied for 24 h, the signals were only observed on the surface of the skin. In contrast, 12 h later, strong signals were detected showing that TMR-11R had arrived at the skin basal layer. Moreover, 24 and 48 hours later, the signals had spread out more and were stronger in both epidermis and dermis | |
| Tissue Sample | Skin from the back of a brown guinea pig | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C (=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C (=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N [C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C (=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C (=O)N[C@@H]([C@@H](C)CC)C=O | |