| PRIMARY INFORMATION |
|---|
| ID | 1008 |
| PMID | 24842663 |
| Year | 2014 |
| Sequence | AAPV |
| Name | C10(D,L)-Laa-AAPV |
| Length | 4 |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | None |
| Origin of Peptide | Synthetic |
| Nature of Peptide/Cargo | It fits the P-P1 subsites of elastase and inhibits HNE competitively |
| Mechanism | Increased lipophilicity enhances permeation, enantiomeric selectivity is apparent |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | Franz diffusion cell, HPLC |
| Enhancer | short chain lipoamino acids (Laa: C10) |
| Properties of enhancer | α-amino acids with a hydrocarbon side chain enhances permeability |
| Concentration | 2 mg in 200 μL of propylene glycol |
| Incubation time | 24 hours |
| Tissue permeability (value with units) | Epidermal flux=8.92 μg/cm2/h, Permeability coefficient=2.9×10−3 Kp(cm/h) |
| Tissue Sample | Human epidermal membranes were obtained by heat separation of whole skin |
| Ex vivo/In vivo/In vitro | in vitro |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1C CC[C@H]1C(=O)N[C@@H](C(C)C)C=O |