Details of TopicalPdb ID 1006
| ID | 1006 | |
| PMID | 24842663 | |
| Year | 2014 | |
| Sequence | AAPV | |
| Name | C8(D)-Laa-AAPV | |
| Length | 4 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | It fits the P-P1 subsites of elastase and inhibits HNE competitively | |
| Mechanism | Increased lipophilicity enhances permeation, enantiomeric selectivity is apparent | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Franz diffusion cell, HPLC | |
| Enhancer | short chain lipoamino acids (Laa: C8) | |
| Properties of enhancer | α-amino acids with a hydrocarbon side chain enhances permeability | |
| Concentration | 2 mg in 200 μL of propylene glycol | |
| Incubation time | 24 hours | |
| Tissue permeability (value with units) | Epidermal flux=7.42 μg/cm2/h, Permeability coefficient=1.90×10−2 Kp(cm/h) | |
| Tissue Sample | Human epidermal membranes were obtained by heat separation of whole skin | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1C CC[C@H]1C(=O)N[C@@H](C(C)C)C=O | |