| ID | 1001 | |
| PMID | 25269793 | |
| Year | 2014 | |
| Sequence | ACSSSPSKHCG | |
| Name | TD1 | |
| Length | 11 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Cyclic (C2-C10) | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | De novo synthesis | |
| Nature of Peptide/Cargo | TD1 enhances the transdermal delivery of macromolecules | |
| Mechanism | TD1 overcomes the skin barrier by a distinct mechanism that most likely involves specific interactions between TD1 and unknown skin components | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | hEGF | |
| Assay | Franz diffusion cells | |
| Enhancer | ATP | |
| Properties of enhancer | The direct ATP addition can benefit the permeation of TD1-hEGF across skin and its effect is dose-dependent. | |
| Concentration | 500 µl | |
| Incubation time | 4 hours | |
| Tissue permeability (value with units) | Significant increase in permeability of the peptide can be seen by the addition of ATP.The amount of protein that permeated the skin was determined with ELISA | |
| Tissue Sample | Male SD rats skin cells | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](C)C(=O)N[C@H]1CSSC [C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H] (NC(=O)[C@H]2N(C(=O)[C@@H](NC(=O)[C@@H] (NC(=O)[C@@H](NC1=O)CO)CO)CO)CCC2)CO) CCCC[NH3])Cc1nc[nH]c1)C(=O)NCC=O | |