Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence PP |
| Primary information | |
|---|---|
| SAPdb ID | 1936, |
| PMID | 28552420 |
| Peptide Name | Boc-L-Pro-cystamine-L-Pro-Boc |
| Peptide sequence | PP |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Boc |
| Non-Terminal Modification | cystamine |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | NMR |
| Solvent | NaHCO3, water, and saturated aqueous NaCl |
| Temperature | Room temperature |
| Incubation Time | 17 h |
| Year | 2017 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| NA | |
| NA | |
| NA | |
| NA | |
| PP | |
| N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1937, |
| PMID | 28552420 |
| Peptide Name | Boc-D-Pro-cystamine-D-Pro-Boc |
| Peptide sequence | PP |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Boc |
| Non-Terminal Modification | cystamine |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | NMR |
| Solvent | NaHCO3, water, and saturated aqueous NaCl |
| Temperature | Room temperature |
| Incubation Time | 17 h |
| Year | 2017 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| NA | |
| NA | |
| NA | |
| NA | |
| PP | |
| N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O | |