Details of SAPdb ID 1936 |
Primary information | ||
---|---|---|
SAPdb_ID | 1936 | |
PMID | 28552420 | |
Year | 2017 | |
Name | Boc-L-Pro-cystamine-L-Pro-Boc | |
Sequence | PP | |
N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
C-Terminal Modification | Boc | |
Non-terminal Modication | cystamine | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | NMR | |
Solvent | NaHCO3, water, and saturated aqueous NaCl | |
Method | NA | |
Concentration | NA | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | 17 h | |
Self-Assembly Formation | No | |
Type of Self-Assembly | NA | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | NA | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O |