Details of SAPdb entry with Sequence LV |
Primary information | |
---|---|
SAPdb ID | 1920, |
PMID | 28485150 |
Peptide Name | BocNH-Leu-FFSAA-Val-OMe (9b) |
Peptide sequence | LV |
N-Terminal Modification | Boc (or t-butoxycarbonyl) |
C-Terminal Modification | Methoxy |
Non-Terminal Modification | fluorinated furanoid sugar amino acid (FFSAA) |
Length | 2 |
Peptide/Conjuagate | Peptide |
Conjugate partner | None |
Technique | Scanning Electron Microscopy (SEM) |
Solvent | HATU |
Conc | 1 mmol |
Temperature | 0 °C |
Incubation Time | 5h |
Year | 2017 |
Self assembly | Yes |
Type of Self assembly | Nanorods |
Tertiary Structure (Technique) | Not Predicted), |
NA | |
NA | |
NA | |
Nanorod | |
NA | |
LV | |
N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
Primary information | |
SAPdb ID | 1923, |
PMID | 28485150 |
Peptide Name | BocNH-Leu-SAA-Val-OMe (15b) |
Peptide sequence | LV |
N-Terminal Modification | Boc (or t-butoxycarbonyl) |
C-Terminal Modification | Methoxy |
Non-Terminal Modification | SAA |
Length | 2 |
Peptide/Conjuagate | Peptide |
Conjugate partner | None |
Technique | Scanning Electron Microscopy (SEM) |
Solvent | CMPI |
Conc | 1 mmol |
Temperature | 0 °C |
Incubation Time | 5h |
Year | 2017 |
Self assembly | No |
Type of Self assembly | NA |
Tertiary Structure (Technique) | Not Predicted), |
NA | |
NA | |
NA | |
NA | |
NA | |
LV | |
N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
Primary information | |
SAPdb ID | 1945, |
PMID | 28589640 |
Peptide Name | Boc-Leu-Val-OMe |
Peptide sequence | LV |
N-Terminal Modification | Boc (or t-butoxycarbonyl) |
C-Terminal Modification | Methoxy |
Non-Terminal Modification | None |
Length | 2 |
Peptide/Conjuagate | Peptide |
Conjugate partner | None |
Technique | SEM, circular dichroism, attenuated total internal reflection-fourier transform infrared spectroscopy, X-ray diffraction and microscopy |
Solvent | organic solvents |
Conc | 6 mM |
Temperature | Room temperature |
Incubation Time | 30 min |
Year | 2017 |
Self assembly | Yes |
Type of Self assembly | Nanotubes |
Tertiary Structure (Technique) | Not Predicted), |
Linear | |
NA | |
NA | |
Nanotube | |
NA | |
LV | |
N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |