Details of SAPdb ID 1920 |
Primary information | ||
---|---|---|
SAPdb_ID | 1920 | |
PMID | 28485150 | |
Year | 2017 | |
Name | BocNH-Leu-FFSAA-Val-OMe (9b) | |
Sequence | LV | |
N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
C-Terminal Modification | Methoxy | |
Non-terminal Modication | fluorinated furanoid sugar amino acid (FFSAA) | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | HATU | |
Method | NA | |
Concentration | 1 mmol | |
pH | NA | |
Temperature | 0 °C | |
Incubation Period | 5h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanorods | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | NA | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O |