Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence LF |
| Primary information | |
|---|---|
| SAPdb ID | 1737, |
| PMID | 30589529 |
| Peptide Name | Amoc-LF-OH |
| Peptide sequence | LF |
| N-Terminal Modification | Amoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Technique | fluorescence spectroscopic |
| Solvent | aqueous NaOH + HCl |
| Conc | 0.5 N + 0.1N |
| Temperature | 7.4 |
| Temperature | 37 °C |
| Incubation Time | 15 min |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanostructure | |
| NA | |
| LF | |
| N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1787, |
| PMID | 30348428 |
| Peptide Name | DL-Leu-DL-Phe |
| Peptide sequence | LF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Temperature | 7.6 |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| LF | |
| N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1804, |
| PMID | 30892363 |
| Peptide Name | oligopeptide |
| Peptide sequence | LF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Solvent | sodium pHospHate buffer |
| Conc | 10mM |
| Temperature | 7 |
| Temperature | Room temperature |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | supramolecular complexes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| supramolecular complexes | |
| NA | |
| LF | |
| N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1807, |
| PMID | 30892363 |
| Peptide Name | oligopeptide |
| Peptide sequence | LF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Solvent | sodium pHospHate buffer |
| Conc | 10mM |
| Temperature | 7 |
| Temperature | Room temperature |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | supramolecular complexes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| supramolecular complexes | |
| NA | |
| NA | |
| N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1889, |
| PMID | 27841381 |
| Peptide Name | leucine- Phenylalanine (LF) |
| Peptide sequence | LF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM and SEM |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| LF | |
| N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |