Welcome to Entry Card of Peptide
Details of SAPdb ID 1737 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1737 | |
| PMID | 30589529 | |
| Year | 2019 | |
| Name | Amoc-LF-OH | |
| Sequence | LF | |
| N-Terminal Modification | Amoc | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | fluorescence spectroscopic | |
| Solvent | aqueous NaOH + HCl | |
| Method | NA | |
| Concentration | 0.5 N + 0.1N | |
| pH | 7.4 | |
| Temperature | 37 °C | |
| Incubation Period | 15 min | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanostructures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |