Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence KYF |
| Primary information | |
|---|---|
| SAPdb ID | 1131, |
| PMID | 25515887 |
| Peptide Name | KYF |
| Peptide sequence | KYF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM), DLS (Dynamic Light Scattering) and FTIR (Fourier Transform Infrared) |
| Solvent | water |
| Method | Tripeptide was dissolved in water by sonication and vortexing, followed by bringing the pH to 7.2 ± 0.1 by dropwise addition of 0.25 M NaOH solution to a final concentration of 30 mmol. Characterization of the resulting samples took place at least 24 h after sample preparation |
| Conc | 30mMol/L |
| Temperature | 7 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1752, |
| PMID | 30882795 |
| Peptide Name | FITC-KYF-Pt-NE |
| Peptide sequence | KYF |
| N-Terminal Modification | FITC |
| C-Terminal Modification | Pt-NE |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | FITC |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | pHospHate buffer saline (PBS) |
| Temperature | 37 °C |
| Incubation Time | 15 min |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanostructure | |
| NA | |
| None | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1997, |
| PMID | 28463516 |
| Peptide Name | lysine-tyrosine-Phenylalanine (KYF) |
| Peptide sequence | KYF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | sodium phosphate buffer |
| Conc | 0.1 M |
| Temperature | 8 |
| Incubation Time | 24 h |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Nanofibres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| None | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1998, |
| PMID | 28463516 |
| Peptide Name | KYpF (H-Lys-Tyr(PO3H2)-Phe-OH) |
| Peptide sequence | KYF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | PO3H2 |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | sodium phosphate buffer |
| Conc | 0.1 M |
| Temperature | 8 |
| Incubation Time | 24 h |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Nanofibres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| None | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |