Welcome to Entry Card of Peptide
Details of SAPdb ID 1752 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1752 | |
| PMID | 30882795 | |
| Year | 2019 | |
| Name | FITC-KYF-Pt-NE | |
| Sequence | KYF | |
| N-Terminal Modification | FITC | |
| C-Terminal Modification | Pt-NE | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | FITC | |
| Technique | Transmission Electron Microscopy (TEM) | |
| Solvent | pHospHate buffer saline (PBS) | |
| Method | NA | |
| Concentration | NA | |
| pH | NA | |
| Temperature | 37 °C | |
| Incubation Period | 15 min | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |