Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence KE |
| Primary information | |
|---|---|
| SAPdb ID | 1896, |
| PMID | 27940033 |
| Peptide Name | L-Lysine(Lys)-L-glutamic acid(Glu) dipeptide |
| Peptide sequence | KE |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FT-IR, SEM and XRD (X-ray diffraction) |
| Solvent | DMSO/H2O |
| Method | sonication |
| Temperature | 7.4 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| LE | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1898, |
| PMID | 27940033 |
| Peptide Name | Fmoc-L-Lys(Fmoc)-L-Glu(OMe)-OMe |
| Peptide sequence | KE |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM and SEM |
| Solvent | DMSO/H2O |
| Method | sonication |
| Temperature | 7.4 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| LE | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1899, |
| PMID | 27940033 |
| Peptide Name | Fmoc-L-Lys(Fmoc)-L-Glu(OtBu)-OMe |
| Peptide sequence | KE |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM and SEM |
| Solvent | DMSO/H2O |
| Method | sonication |
| Temperature | 7.4 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| LE | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1900, |
| PMID | 27940033 |
| Peptide Name | Boc-L-Lys(Fmoc)-L-Glu(OMe)-OMe |
| Peptide sequence | KE |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM and SEM |
| Solvent | DMSO/H2O |
| Method | sonication |
| Temperature | 7.4 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| LE | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1901, |
| PMID | 27940033 |
| Peptide Name | Boc-L-Lys(Fmoc)-L-Glu(OtBu)-OMe |
| Peptide sequence | KE |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM and SEM |
| Solvent | DMSO/H2O |
| Method | sonication |
| Temperature | 7.4 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| LE | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1905, |
| PMID | 27940033 |
| Peptide Name | Fmoc-L-Lys(Fmoc)-L-Glu(OR)-OMe |
| Peptide sequence | KE |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM and SEM |
| Solvent | DMSO/H2O |
| Method | sonication |
| Temperature | 7.4 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| LE | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |
| Primary information | |
| SAPdb ID | 1906, |
| PMID | 27940033 |
| Peptide Name | Boc-L-Lys(Fmoc)-L-Glu(OR)-OMe |
| Peptide sequence | KE |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM and SEM |
| Solvent | DMSO/H2O |
| Method | sonication |
| Temperature | 7.4 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2016 |
| Self assembly | Yes |
| Type of Self assembly | Fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| LE | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |