Details of SAPdb ID 1906 |
Primary information | ||
---|---|---|
SAPdb_ID | 1906 | |
PMID | 27940033 | |
Year | 2016 | |
Name | Boc-L-Lys(Fmoc)-L-Glu(OR)-OMe | |
Sequence | KE | |
N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
C-Terminal Modification | Methoxy | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | TEM and SEM | |
Solvent | DMSO/H2O | |
Method | sonication | |
Concentration | NA | |
pH | 7.4 | |
Temperature | Room temperature | |
Incubation Period | 24 h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Fibrils | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O |