Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence KCR |
| Primary information | |
|---|---|
| SAPdb ID | 1769, |
| PMID | 31039607 |
| Peptide Name | lysine(N3)-cysteine-asparagine |
| Peptide sequence | KCR |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated |
| Conjugate partner | azide |
| Technique | High-resolution transmission electron microscopy (HRTEM), differential centrifugal sedimentation (DCS), and 1H-DOSY NMR spectroscopy |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanoparticle | |
| 2 | |
| None | |
| N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O | |