Welcome to Entry Card of Peptide
Details of SAPdb ID 1769 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1769 | |
| PMID | 31039607 | |
| Year | 2019 | |
| Name | lysine(N3)-cysteine-asparagine | |
| Sequence | KCR | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | conjugated | |
| Conjugate Partner | azide | |
| Technique | High-resolution transmission electron microscopy (HRTEM), differential centrifugal sedimentation (DCS), and 1H-DOSY NMR spectroscopy | |
| Solvent | NA | |
| Method | NA | |
| Concentration | NA | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | 2nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O | |