Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence IV |
| Primary information | |
|---|---|
| SAPdb ID | 1735, |
| PMID | 30459362 |
| Peptide Name | acetylated-Ile-Val-Xaa |
| Peptide sequence | IV |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Xaa(His, Arg, Asn) |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Technique | field emission scanning electron microscopy (FESEM) and circular dichroism spectroscopy |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Other | |
| NA | |
| IV | |
| N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |