Welcome to Entry Card of Peptide
Details of SAPdb ID 1735 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1735 | |
| PMID | 30459362 | |
| Year | 2018 | |
| Name | acetylated-Ile-Val-Xaa | |
| Sequence | IV | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Xaa(His, Arg, Asn) | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | field emission scanning electron microscopy (FESEM) and circular dichroism spectroscopy | |
| Solvent | NA | |
| Method | NA | |
| Concentration | NA | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |