Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence HR |
| Primary information | |
|---|---|
| SAPdb ID | 1967, |
| PMID | 28719861 |
| Peptide Name | L-His-L-Arg-OMe |
| Peptide sequence | HR |
| N-Terminal Modification | Free |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | UV-visible (UV-vis) spectroscopy, transmission electron microscopy (TEM), Fourier transform infrared (FT-IR) spectroscopy, thermo-gravimetric analysis (TGA), powder X-ray diffraction (XRD) and gel electrophoresis |
| Solvent | DMF |
| Conc | 3 ml |
| Temperature | Room temperature |
| Incubation Time | 48 hours |
| Year | 2017 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| NA | |
| NA | |
| NA | |
| NA | |
| HR | |
| N[C@@]([H])(CC1=CN=C-N1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O | |