Welcome to Entry Card of Peptide
Details of SAPdb ID 1967 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1967 | |
| PMID | 28719861 | |
| Year | 2017 | |
| Name | L-His-L-Arg-OMe | |
| Sequence | HR | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Methoxy | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | UV-visible (UV-vis) spectroscopy, transmission electron microscopy (TEM), Fourier transform infrared (FT-IR) spectroscopy, thermo-gravimetric analysis (TGA), powder X-ray diffraction (XRD) and gel electrophoresis | |
| Solvent | DMF | |
| Method | NA | |
| Concentration | 3 ml | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 48 hours | |
| Self-Assembly Formation | No | |
| Type of Self-Assembly | NA | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | NA | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC1=CN=C-N1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O | |