Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence Glu-Glu |
| Primary information | |
|---|---|
| SAPdb ID | 1699, |
| PMID | 30147806 |
| Peptide Name | Hollow gold nanoparticles (HGNPs) |
| Peptide sequence | Glu-Glu |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Cys-NH2 |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated tripeptide |
| Conjugate partner | EEC-HGNPs |
| Technique | HRTEM micrograpH |
| Solvent | MeO-PEG-SH |
| Conc | 4 mg/mL, 125 μL) |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| EE | |
| N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |