Welcome to Entry Card of Peptide
Details of SAPdb ID 1699 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1699 | |
| PMID | 30147806 | |
| Year | 2018 | |
| Name | Hollow gold nanoparticles (HGNPs) | |
| Sequence | Glu-Glu | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Cys-NH2 | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | conjugated tripeptide | |
| Conjugate Partner | EEC-HGNPs | |
| Technique | HRTEM micrograpH | |
| Solvent | MeO-PEG-SH | |
| Method | NA | |
| Concentration | 4 mg/mL, 125 μL) | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 24 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O | |