Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence DVV |
| Primary information | |
|---|---|
| SAPdb ID | 1793, |
| PMID | 30642185 |
| Peptide Name | Asp−Val−Val |
| Peptide sequence | DVV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | UV−Vis Absorption and pHotoluminescence (PL) Spectroscopy, FT-IR, CD, TEM HPLC |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| alipHatic | |
| NA | |
| Nanostructure | |
| NA | |
| None | |
| N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1955, |
| PMID | 28683194 |
| Peptide Name | Asp-Val-Val (DVV) |
| Peptide sequence | DVV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanostructure | |
| NA | |
| None | |
| N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1958, |
| PMID | 28683194 |
| Peptide Name | DVV-C10 |
| Peptide sequence | DVV |
| N-Terminal Modification | Free |
| C-Terminal Modification | C10 |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanostructure | |
| 200 | |
| None | |
| N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1959, |
| PMID | 28683194 |
| Peptide Name | DVV-OPV3 |
| Peptide sequence | DVV |
| N-Terminal Modification | Free |
| C-Terminal Modification | OPV3 |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanostructure | |
| 500 | |
| None | |
| N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |