Welcome to Entry Card of Peptide
Details of SAPdb ID 1793 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1793 | |
| PMID | 30642185 | |
| Year | 2019 | |
| Name | Asp−Val−Val | |
| Sequence | DVV | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | UV−Vis Absorption and pHotoluminescence (PL) Spectroscopy, FT-IR, CD, TEM HPLC | |
| Solvent | NA | |
| Method | NA | |
| Concentration | NA | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanostructures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | alipHatic | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |