Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence DIF |
| Primary information | |
|---|---|
| SAPdb ID | 1719, |
| PMID | 30398280 |
| Peptide Name | Ac-DIF-NH2 |
| Peptide sequence | DIF |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | water of 0.87 wt% |
| Conc | 20 mM |
| Temperature | Room temperature |
| Incubation Time | 2 h |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanostructure | |
| 15-20 | |
| None | |
| N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |