Details of SAPdb ID 1719 |
Primary information | ||
---|---|---|
SAPdb_ID | 1719 | |
PMID | 30398280 | |
Year | 2018 | |
Name | Ac-DIF-NH2 | |
Sequence | DIF | |
N-Terminal Modification | Acetylation | |
C-Terminal Modification | Amidation | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | tripeptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | water of 0.87 wt% | |
Method | NA | |
Concentration | 20 mM | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | 2 h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanostructures | |
Size of Self-Assembled structure | 15–20 nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |