| Primary information |
|---|
| PRRID | PRRID_0105 |
| Ligand Name | MDP (muramyldipeptide) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | NLRP1 |
| Type of receptor | NLR |
| Source | Mice |
| Localization | cortical neurons (cell culture, stroke model) |
| Domain | NA |
| Sequence of Receptor | Q2LKU9.fasta |
| Swiss prot ID | Q2LKU9 |
| Length Of Receptor | 1182 |
| Function | protein ‚Üë in ischemia/reperfusion, role in neuronal cell death and behavioral deficits |
| Assay used | NA |
| PMID | 28801521 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Pdb | PRR_0105.pdb |
| 3-D Structure | PRR_0105 (View) or (Download) |