| Primary information |
|---|
| PRRID | PRRID_0098 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | NA |
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces astrocyte activation and up-regulation of proinflammatory cytokines and chemokines, including IFN-, TNF, CCL2, and CXCL10 |
| Name of receptor | TLR7 |
| Type of receptor | TLR |
| Source | Newborn Mice |
| Localization | Astrocytes and microglia |
| Domain | LRR |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | It induces a neuroinflammatory response in CNS. |
| Assay used | Cytokines assay |
| PMID | 18490763 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Pdb | PRR_0098.pdb |
| 3-D Structure | PRR_0098 (View) or (Download) |