| Primary information |
|---|
| PRRID | PRRID_0097 |
| Ligand Name | Bropirimine |
| Source | NA |
| Sequence of ligand | C1=CC=C(C=C1)C2=C(C(=O)N=C(N2)N)Br |
| Length | NA |
| Type | PAMP |
| Occurence | Synthetic |
| Role of Ligand | experimental drug with anti-cancer and antiviral properties |
| Name of receptor | DUOX2 |
| Type of receptor | TLR |
| Source | Mice |
| Localization | monocyte/macrophages, plasmacytoid DCs and B-lymphocytes |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | important role in the immune response to viral infection |
| Assay used | NA |
| PMID | 24830024 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Pdb | PRR_0097.pdb |
| 3-D Structure | PRR_0097 (View) or (Download) |