| Primary information |
|---|
| PRRID | PRRID_0089 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | DAMPs |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1β, TNF-α and TGF-β by murine macrophages. |
| Name of receptor | NLRP3 |
| Type of receptor | NLR |
| Source | Mice |
| Localization | substantia nigra |
| Domain | NA |
| Sequence of Receptor | Q8R4B8.fasta |
| Swiss prot ID | Q8R4B8 |
| Length Of Receptor | 1033 |
| Function | protein ‚Üë, activation of NLRP3 inflammasome in PD models |
| Assay used | NA |
| PMID | 28801521 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Pdb | PRR_0089.pdb |
| 3-D Structure | PRR_0089 (View) or (Download) |