Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0086 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0086 |
| Ligand Name | CL097 |
| Source | NA |
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces astrocyte activation and up-regulation of proinflammatory cytokines and chemokines, including IFN-, TNF, CCL2, and CXCL10 |
| Name of receptor | TLR8 |
| Type of receptor | TLR |
| Source | Newborn Mice |
| Localization | Astrocytes and microglia |
| Domain | LRR |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | It induces a neuroinflammatory response in CNS. |
| Assay used | Cytokines assay |
| PMID | 18490763 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Pdb | PRR_0086.pdb |
| 3-D Structure | PRR_0086 (View) or (Download) |