| Primary information |
|---|
| PRRID | PRRID_0075 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | TLR22 |
| Type of receptor | TLR |
| Source | Zebrafish |
| Localization | endosomes and lysosomes. |
| Domain | extracellular (or intra- endosomal) ligand-binding domain with a leucine-rich repeat (LRR) motif and a cytoplasmic signaling Toll/Interleukin-1 (IL-1) receptor homology (TIR) domain |
| Sequence of Receptor | B3DJL6.fasta |
| Swiss prot ID | B3DJL6 |
| Length Of Receptor | 947 |
| Function | induce IFN expression |
| Assay used | NA |
| PMID | 27721456 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Pdb | PRR_0075.pdb |
| 3-D Structure | PRR_0075 (View) or (Download) |