| Primary information |
|---|
| PRRID | PRRID_0068 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | act as a TLR3 agonist and induces protective responses against rapidly growing tumor cells |
| Name of receptor | TLR3 |
| Type of receptor | TLR |
| Source | Chicken |
| Localization | Dendritic Cell, B-lymphocyte |
| Domain | cell compartment |
| Sequence of Receptor | Q0PQ88.fasta |
| Swiss prot ID | Q0PQ88 |
| Length Of Receptor | 896 |
| Function | TLRs promote cellular activation and the production of cytokines such as interleukin (IL)-12 and interferon (IFN)-c In the case of antigen presenting cells (APCs), TLR stimulation also promotes the up-regulation of major histocompatibility complex class II (MHC-II) and co- stimulatory molecules including CD80 therefore elicitation of a robust adaptive immune response |
| Assay used | ELISA |
| PMID | 24797893 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Pdb | PRR_0068.pdb |
| 3-D Structure | PRR_0068 (View) or (Download) |