| Primary information |
|---|
| PRRID | PRRID_0036 |
| Ligand Name | Hypochlorite modified HDL |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | It has a high affinity for the Lectin-like oxidized low density lipoprotein receptor 1 (LOX-1). |
| Name of receptor | Scavenger receptor class B, type I (SR-BI) |
| Type of receptor | Scavenger receptor |
| Source | Mice (Murine) |
| Localization | CHO Cells—ldlA cells |
| Domain | NA |
| Sequence of Receptor | Q06BI8.fasta |
| Swiss prot ID | Q06BI8 |
| Length Of Receptor | 494 |
| Function | It impairs high density lipoprotein-dependent selective lipid uptake and reverse cholesterol transport. |
| Assay used | NA |
| PMID | 12070141 |
| Year of Publication | 2002 |
| Pubchem assay | NA |
| Pdb | PRR_0036.pdb |
| 3-D Structure | PRR_0036 (View) or (Download) |