| Primary information |
|---|
| PRRID | PRRID_0028 |
| Ligand Name | Mannan |
| Source | Fungi(Yeast) |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Polysaccharides |
| Occurence | Natural |
| Role of Ligand | cell wall polysaccharide found in yeasts. |
| Name of receptor | Mannose receptor |
| Type of receptor | Mannose receptor |
| Source | European and African Children |
| Localization | DC-SIGN (dendritic cell-specific intercellular adhesion molecule-3-grabbing non-integrin) |
| Domain | NA |
| Sequence of Receptor | A5D8T8.fasta |
| Swiss prot ID | A5D8T8 |
| Length Of Receptor | 446 |
| Function | Phagocytosis of pathogens, Antigen presentation, Intracellular signalling, Resolution of inflammation |
| Assay used | ELISA |
| PMID | 24743542 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Pdb | PRR_0028.pdb |
| 3-D Structure | PRR_0028 (View) or (Download) |