| Primary information |
|---|
| PRRID | PRRID_0018 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | OxLDL pretreatment increased expression of macrosialin. |
| Name of receptor | Microsialin |
| Type of receptor | Scavenger receptor |
| Source | Mice |
| Localization | Peritoneal macrophages |
| Domain | NA |
| Sequence of Receptor | A0A0R4J1C8.fasta |
| Swiss prot ID | A0A0R4J1C8 |
| Length Of Receptor | 335 |
| Function | It leads to the binding and uptake of oxidised form of LDL by resident mouse peritoneal macrophages. |
| Assay used | Endocytic degradation assays |
| PMID | 9598839 |
| Year of Publication | 1998 |
| Pubchem assay | NA |
| Pdb | PRR_0018.pdb |
| 3-D Structure | PRR_0018 (View) or (Download) |