| Primary information |
|---|
| PRRID | PRRID_0005 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram negative bacteria, Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | DjCTL |
| Type of receptor | CTL |
| Source | Dugesia japonica |
| Localization | Pharyngeal and epidermis |
| Domain | Doamin of CLECT |
| Sequence of Receptor | A0A1L2DBR5.fasta |
| Swiss prot ID | A0A1L2DBR5 |
| Length Of Receptor | 107 |
| Function | foreign invaders and phagocytize or encapsulate the aggregates of killed bacteria which have been digested in intestinal cavity. |
| Assay used | Microbial binding assay |
| PMID | 27565408 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Pdb | PRR_0005.pdb |
| 3-D Structure | PRR_0005 (View) or (Download) |