| Primary information |
|---|
| PRRID | PRRID_2739 |
| Ligand Name | Dap-type PGN |
| Source | Gram-negative E. Coli and L. anguillarum, as well as Gram-positive M. |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | rSgPGRP-S1 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 29208495 |
| Year of Publication | 2018 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2739 |
| Ligand Name | Dap-type PGN |
| Source | Gram-negative E. Coli and L. anguillarum, as well as Gram-positive M. |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | rSgPGRP-S1 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 29208495 |
| Year of Publication | 2018 |
| Pubchem assay | NA |