| Primary information |
|---|
| PRRID | PRRID_2706 |
| Ligand Name | β-glucan |
| Source | gram-negative bacteria, fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | rSgSABL-1 |
| Type of receptor | Lectins |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | induces pro-inflammatory cytokine response |
| Assay used | NA |
| PMID | 29146448 |
| Year of Publication | 2018 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2706 |
| Ligand Name | β-glucan |
| Source | gram-negative bacteria, fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | rSgSABL-1 |
| Type of receptor | Lectins |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | induces pro-inflammatory cytokine response |
| Assay used | NA |
| PMID | 29146448 |
| Year of Publication | 2018 |
| Pubchem assay | NA |