| Primary information |
|---|
| PRRID | PRRID_2705 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | gram-negative bacteria, fungi |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | rSgSABL-1 |
| Type of receptor | Lectins |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | induces pro-inflammatory cytokine response |
| Assay used | NA |
| PMID | 29146448 |
| Year of Publication | 2018 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2705 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | gram-negative bacteria, fungi |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | rSgSABL-1 |
| Type of receptor | Lectins |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | induces pro-inflammatory cytokine response |
| Assay used | NA |
| PMID | 29146448 |
| Year of Publication | 2018 |
| Pubchem assay | NA |