| Primary information |
|---|
| PRRID | PRRID_2699 |
| Ligand Name | β­glucan |
| Source | Fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | human peripheral B­lymphocytes |
| Domain | NA |
| Sequence of Receptor | Q96P20.fasta |
| Swiss prot ID | Q96P20 |
| Length Of Receptor | 1036 |
| Function | NA |
| Assay used | NA |
| PMID | 29170665 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2699 |
| Ligand Name | β­glucan |
| Source | Fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | human peripheral B­lymphocytes |
| Domain | NA |
| Sequence of Receptor | Q96P20.fasta |
| Swiss prot ID | Q96P20 |
| Length Of Receptor | 1036 |
| Function | NA |
| Assay used | NA |
| PMID | 29170665 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |