Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_2679 details |
| Primary information | |
|---|---|
| PRRID | PRRID_2679 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1, IL-6, IL-8, TNF-α, TXA2 and PGE2 by human monocytes. |
| Name of receptor | NA |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Monocyte |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information | |
|---|---|
| PRRID | PRRID_2679 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1, IL-6, IL-8, TNF-α, TXA2 and PGE2 by human monocytes. |
| Name of receptor | NA |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Monocyte |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |