| Primary information |
|---|
| PRRID | PRRID_2678 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1, IL-6, IL-8, TNF-α, TXA2 and PGE2 by human monocytes. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Monocyte |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2678 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1, IL-6, IL-8, TNF-α, TXA2 and PGE2 by human monocytes. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Monocyte |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |