| Primary information |
|---|
| PRRID | PRRID_2677 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1β, TNF-α and TGF-β by murine macrophages. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUN6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2677 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1β, TNF-α and TGF-β by murine macrophages. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUN6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |