| Primary information |
|---|
| PRRID | PRRID_2674 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1β, TNF-α and TGF-β by murine macrophages. |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Rat |
| Localization | primary astrocytes |
| Domain | NA |
| Sequence of Receptor | D4A523.fasta |
| Swiss prot ID | D4A523 |
| Length Of Receptor | 1035 |
| Function | protein ‚Üë, activation of NLRP3 inflammasome in PD models |
| Assay used | NA |
| PMID | 28801521 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2674 |
| Ligand Name | Uric acid |
| Source | NA |
| Sequence of ligand | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the synthesis of IL-1β, TNF-α and TGF-β by murine macrophages. |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Rat |
| Localization | primary astrocytes |
| Domain | NA |
| Sequence of Receptor | D4A523.fasta |
| Swiss prot ID | D4A523 |
| Length Of Receptor | 1035 |
| Function | protein ‚Üë, activation of NLRP3 inflammasome in PD models |
| Assay used | NA |
| PMID | 28801521 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |