| Primary information |
|---|
| PRRID | PRRID_2650 |
| Ligand Name | Teneligliptin |
| Source | NA |
| Sequence of ligand | CC1=NN(C(=C1)N2CCN(CC2)C3CC(NC3)C(=O)N4CCSC4)C5=CC=CC=C5 |
| Length | NA |
| Type | DPP4 inhibitor |
| Occurence | Natural |
| Role of Ligand | anti- inflammatory activity |
| Name of receptor | cav-1 |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | P49817.fasta |
| Swiss prot ID | P49817 |
| Length Of Receptor | 178 |
| Function | NA |
| Assay used | NA |
| PMID | 29113797 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2650 |
| Ligand Name | Teneligliptin |
| Source | NA |
| Sequence of ligand | CC1=NN(C(=C1)N2CCN(CC2)C3CC(NC3)C(=O)N4CCSC4)C5=CC=CC=C5 |
| Length | NA |
| Type | DPP4 inhibitor |
| Occurence | Natural |
| Role of Ligand | anti- inflammatory activity |
| Name of receptor | cav-1 |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | P49817.fasta |
| Swiss prot ID | P49817 |
| Length Of Receptor | 178 |
| Function | NA |
| Assay used | NA |
| PMID | 29113797 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |