| Primary information |
|---|
| PRRID | PRRID_2644 |
| Ligand Name | Taxol |
| Source | NA |
| Sequence of ligand | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Enhancement of dendritic cell maturation and alloreactive T-cell responses, Upregulate mRNA expressions of MCP-Ôõú, TNF- a, induction of proinflammatory cytokines, accelerate podocyte injury |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | NA |
| Assay used | NA |
| PMID | 29028369 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2644 |
| Ligand Name | Taxol |
| Source | NA |
| Sequence of ligand | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Enhancement of dendritic cell maturation and alloreactive T-cell responses, Upregulate mRNA expressions of MCP-Ôõú, TNF- a, induction of proinflammatory cytokines, accelerate podocyte injury |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | NA |
| Assay used | NA |
| PMID | 29028369 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |