| Primary information |
|---|
| PRRID | PRRID_2631 |
| Ligand Name | Soluble Beta glucan |
| Source | NA |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Dectin-1 (Clec7a) |
| Type of receptor | Syk-coupled CLR |
| Source | Infection model |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Protective role in infection model |
| Assay used | NA |
| PMID | 28167651 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2631 |
| Ligand Name | Soluble Beta glucan |
| Source | NA |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Dectin-1 (Clec7a) |
| Type of receptor | Syk-coupled CLR |
| Source | Infection model |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Protective role in infection model |
| Assay used | NA |
| PMID | 28167651 |
| Year of Publication | 2017 |
| Pubchem assay | NA |